p-Nitrophenyl 2-Azido-2-deoxy-?-D-galactopyranoside [CAS 210418-04-5]
Partner: Toronto Research Chemicals
| CAS No: | 210418-04-5 |
| MW: | 326.26 |
| Formula: | C12H14N4O7 |
| SMILES: | O[C@@H]1[C@H](O)[C@@H](N=[N+]=[N-])[C@@H](OC2=CC=C([N+]([O-])=O)C=C2)O[C@@H]1CO |
| Description: | Appearance: White to Off-White Solid |
| Further Information: | Solubility: DMSO (Slightly), Methanol (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | Refrigerator, Under Inert Atmosphere |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
