p-Nitrophenyl 2-Acetamido-2-deoxy-4-O-(?-D-galactopyranosyl)-?-D-glucopyranoside [CAS 184377-56-8]
Partner: Toronto Research Chemicals
| CAS No: | 184377-56-8 |
| MW: | 504.44 |
| Formula: | C20H28N2O13 |
| SMILES: | OC[C@H]1O[C@H](OC2=CC=C([N+]([O-])=O)C=C2)[C@H](NC(C)=O)[C@@H](O)[C@@H]1O[C@H]3[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O3 |
| Description: | Appearance: White to Off-White Solid |
| Further Information: | Solubility: Methanol (Slightly), Water (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | Hygroscopic, -20 C Freezer, Under inert atmosphere |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
