6-Iodoacetamidotetramethyl Rhodamine, (Technical grade) [CAS 159435-00-4]
Partner: Toronto Research Chemicals
| CAS No: | 159435-00-4 |
| MW: | 569.39 |
| Formula: | C??H??IN?O? |
| SMILES: | O=C1OC2(C3=C1C=CC(NC(CI)=O)=C3)C4=CC=C(N(C)C)C=C4OC5=C2C=CC(N(C)C)=C5 |
| Description: | Appearance: Purple to Black Solid |
| Further Information: | Solubility: Mixture of Chloroform and Methanol (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | -20 C, Inert atmosphere |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
