4-O-a-D-Glucopyranosylmoranoline [CAS 80312-32-9]
Partner: Toronto Research Chemicals
| CAS No: | 80312-32-9 |
| MW: | 325.31 |
| Formula: | C??H??NO? |
| SMILES: | OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)CN[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O |
| Description: | Appearance: White to Pale Beige Solid |
| Further Information: | Solubility: Methanol (Very Slightly, Heated, Sonicated), Water (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | -20 C, Hygroscopic |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
