NG,NG�-Dimethy-L-arginine Di(p-hydroxyazobenzene-p�-sulfonate) Salt [CAS 102783-24-4]
Partner: Toronto Research Chemicals
| CAS No: | 102783-24-4 |
| MW: | 758.82 |
| Formula: | C32H38N8O10S2 |
| SMILES: | CN/C(NC)=N/CCC[C@H](N)C(O)=O |
| Description: | Appearance: Orange to Dark Orange Solid |
| Further Information: | Solubility: Methanol (Slightly), Water (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | Hygroscopic, Refrigerator, Under inert atmosphere |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
