D-(+)-Cellohexose [CAS 2478-35-5]
Partner: Toronto Research Chemicals
| CAS No: | 2478-35-5 |
| MW: | 990.9 |
| Formula: | C36H62O31 |
| SMILES: | O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O[C@H]3[C@H](O)[C@@H](O)C(O)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO |
| Description: | Appearance: White Solid |
| Further Information: | Solubility: Water (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | Hygroscopic, -20 C Freezer, Under inert atmosphere |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
