Triprolidine Hydrochloride [CAS 550-70-9]
Partner: Toronto Research Chemicals
| CAS No: | 550-70-9 |
| MW: | 278.40 + 36.46 |
| Formula: | C19H22N2 - HCl |
| SMILES: | CC1=CC=C(C=C1)/C(=C\CN2CCCC2)/C3=CC=CC=N3.Cl |
| Description: | Appearance: White to Off-White Solid |
| Further Information: | Solubility: Chloroform (Slightly), Dichloromethane (Slightly), Water (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | Hygroscopic, Refrigerator, Under inert atmosphere |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
