1-Palmitoyl-2-oleoyl-sn-glycerol-3-phosphocholine-13C16 (Contained up to 2% unlabeled)
Partner: Toronto Research Chemicals
| MW: | 775.96 |
| Formula: | C2613C16H82NO8P |
| SMILES: | O=[13C]([13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH3])OC[C@@H](OC(CCCCCCC/C=C\CCCCCCCC)=O)COP([O-])(OCC[N+](C)(C)C)=O |
| Description: | Appearance: Off-White to Pale Beige Semi-Solid |
| Further Information: | Solubility: Chloroform (Slightly), Methanol (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | Hygroscopic, -20 C Freezer, Under Inert Atmosphere |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
