3-(3,4-Dimethoxyphenyl)propanoic acid [CAS 2107-70-2]
Partner: MedChemexpress LLC
| CAS No: | 2107-70-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 210.23 |
| Formula: | C11H14O4 |
| SMILES: | O=C(O)CCC1=CC=C(OC)C(OC)=C1 |
| Purity: | 99.98 |
| Description: | 3-(3,4-Dimethoxyphenyl)propanoic acid is an orally active short-chain fatty acids (SCFAs). 3-(3,4-Dimethoxyphenyl)propanoic acid stimulates ? globin gene expression, erythropoiesis in vivo and is used for the ? hemoglobinopathies and other anemias[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
