(-)-Di-p-toluoyl-L-tartaric Acid [CAS 32634-66-5]
Partner: MedChemexpress LLC
| CAS No: | 32634-66-5 |
| MW: | 386.35 |
| Formula: | C20H18O8 |
| SMILES: | O=C(O)[C@H](OC(C1=CC=C(C)C=C1)=O)[C@@H](OC(C2=CC=C(C)C=C2)=O)C(O)=O |
| Purity: | 99.94 |
| Description: | (2R,3R)-2,3-Bis((4-methylbenzoyl)oxy)succinic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
