Pentaglycine [CAS 7093-67-6]
Partner: MedChemexpress LLC
| CAS No: | 7093-67-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 303.27 |
| Formula: | C10H17N5O6 |
| SMILES: | O=C(O)CNC(CNC(CNC(CNC(CN)=O)=O)=O)=O |
| Purity: | 99.59 |
| Description: | Pentaglycine (Tetraglycylglycine) is a bridge containing five glycine molecules. Pentaglycine can form highly cross-linked peptidoglycan. Glucose reduced expression of pentaglycine. Pentaglycine is cleaved by lysostaphin, and occurs in the cell envelope of staphylococci[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
