3,5-Di-tert-butylphenol [CAS 1138-52-9]
Partner: MedChemexpress LLC
| CAS No: | 1138-52-9 |
| Applications: | COVID-19-immunoregulation |
| MW: | 206.32 |
| Formula: | C14H22O |
| SMILES: | OC1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 |
| Purity: | 99.98 |
| Description: | 3,5-Di-tert-butylphenol is an volatile organic compound with anti-biofilm and antifungal activities. 3,5-Di-tert-butylphenol induces accumulation of reactive oxygen species (ROS). |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
