7-Methoxycoumarin-3-carboxylic acid [CAS 20300-59-8]
Partner: MedChemexpress LLC
| CAS No: | 20300-59-8 |
| Applications: | Cancer-programmed cell death |
| MW: | 220.18 |
| Formula: | C11H8O5 |
| SMILES: | O=C(C1=CC2=CC=C(OC)C=C2OC1=O)O |
| Purity: | 97.0 |
| Description: | 7-Methoxycoumarin-3-carboxylic acid is a fluorescent dye with an excitation peak at 355 nm and an emission peak at 405 nm. 7-Methoxycoumarin-3-carboxylic acid can be used to label peptide[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
