Tetramethylammonium triacetoxyborohydride [CAS 109704-53-2]
Partner: MedChemexpress LLC
| CAS No: | 109704-53-2 |
| MW: | 263.10 |
| Formula: | C10H22BNO6 |
| SMILES: | C[N+](C)(C)C.CC(O[BH-](OC(C)=O)OC(C)=O)=O |
| Purity: | 98.0 |
| Description: | Tetramethylammonium triacetoxyborohydride (TMAB) belongs to the class of borohydride reagents and consists of a positively charged tetramethylammonium cation and a negatively charged triacetoxyborohydride anion. This compound is commonly used as a reducing agent in organic chemical reactions, especially the reduction of carbonyl compounds such as aldehydes and ketones to their respective alcohols. TMAB has high solubility in various organic solvents and is easy to handle and store compared to other borohydride reagents. Furthermore, TMAB has been investigated for its potential applications in the synthesis of pharmaceuticals and agrochemicals due to its mild reaction conditions and high selectivity. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
