(2R,4S)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate [CAS 135042-17-0]
Partner: MedChemexpress LLC
| CAS No: | 135042-17-0 |
| Applications: | Cancer-programmed cell death |
| MW: | 245.27 |
| Formula: | C11H19NO5 |
| SMILES: | O=C(N1[C@@H](C(OC)=O)C[C@H](O)C1)OC(C)(C)C |
| Purity: | 99.01 |
| Description: | Boc-trans-D-Hyp-OMe is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Boc-trans-D-Hyp-OMe is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
