(-)-Carvone [CAS 6485-40-1]
Partner: MedChemexpress LLC
| CAS No: | 6485-40-1 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 150.22 |
| Formula: | C10H14O |
| SMILES: | O=C1C(C)=CC[C@@H](C(C)=C)C1 |
| Purity: | 99.41 |
| Description: | (-)-Carvone is an insect neurotoxin and a irreversible acetylcholinesterase (AChE) inhibitor. (-)-Carvone can be used as a bird repellent, inhibits larval growth, decreases pupatation rate, and increases mortality of larvae[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
