N-Acetyl-L-glutamic acid-d5
Partner: MedChemexpress LLC
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 194.20 |
| Formula: | C7H6D5NO5 |
| SMILES: | O=C(O)C([2H])([2H])C([2H])([2H])[C@](C(O)=O)([2H])NC(C)=O |
| Purity: | 99.71 |
| Description: | N-Acetyl-L-glutamic acid-d5 is the deuterium labeled N-Acetyl-L-glutamic acid. N-Acetyl-L-glutamic acid, a N-acyl-L-amino acid, is a component of animal cell culturing media. N-Acetyl-L-glutamic acid is a metabolite of Saccharomyces cerevisiae and human[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
