Tricaine (methanesulfonate) [CAS 886-86-2] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 886-86-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 261.29 |
| Formula: | C10H15NO5S |
| SMILES: | O=C(OCC)C1=CC=CC(N)=C1.CS(=O)(O)=O |
| Purity: | 99.52 |
| Description: | Tricaine methanesulfonate (MS-222) is common used to immobilize fish for marking or transport and to suppress sensory systems during invasive procedures[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
