4-Nitrophenyl-N-acetyl-Beta-D-glucosaminide [CAS 3459-18-5]
Partner: MedChemexpress LLC
| CAS No: | 3459-18-5 |
| MW: | 342.30 |
| Formula: | C14H18N2O8 |
| SMILES: | CC(N[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)[C@@H]1OC2=CC=C(C=C2)[N+]([O-])=O)=O |
| Purity: | 99.51 |
| Description: | 4-Nitrophenyl-N-acetyl-?-D-glucosaminide, an artificial substrate of N-acetyl-beta-D-hexosaminidase (NAGase), can be used in rapid and accurate rate assay for N-acetyl-beta-D-hexosaminidase[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
