NLRP3-IN-2 [CAS 16673-34-0] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 16673-34-0 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 368.84 |
| Formula: | C16H17ClN2O4S |
| SMILES: | O=C(NCCC1=CC=C(S(=O)(N)=O)C=C1)C2=CC(Cl)=CC=C2OC |
| Purity: | 98.00 |
| Description: | NLRP3-IN-2, an intermediate substrate in the synthesis of glyburide, inhibits the formation of the NLRP3 inflammasome in cardiomyocytes and limits the infarct size following myocardial ischemia/reperfusion in the mouse, without affecting glucose metabolism[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
