Sulfabrom [CAS 116-45-0]
Partner: MedChemexpress LLC
| CAS No: | 116-45-0 |
| Applications: | COVID-19-immunoregulation |
| MW: | 357.23 |
| Formula: | C12H13BrN4O2S |
| SMILES: | O=S(C1=CC=C(N)C=C1)(NC2=NC(C)=C(Br)C(C)=N2)=O |
| Purity: | 99.39 |
| Description: | Sulfabrom (N 3517; Sulfabromomethazine) is a long-acting Sulfonamide that is used for the treatment of coccidiosis and various bacterial infections in the poultry, swine and cattle. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
