CTP [CAS 1052692-86-0]
Partner: MedChemexpress LLC
| CAS No: | 1052692-86-0 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 1432.54 |
| Formula: | C64H93N19O19 |
| SMILES: | O=C(N1[C@@H](CCC1)C(N[C@@H](CC2=CNC3=CC=CC=C23)C(N[C@@H](CC4=CNC=N4)C(N[C@@H](CC(C)C)C(N[C@@H](CO)C(N[C@@H](CO)C(N[C@@H](CCC(N)=O)C(N[C@@H](CC5=CC=C(C=C5)O)C(N[C@@H](CO)C(N[C@@H](CCCNC(N)=N)C(N[C@@H]([C@H](O)C)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](C)N |
| Purity: | 98.45 |
| Description: | CTP is a cardiac targeting peptide. CTP transduces cardiomyocytes in vitro. CTP leads to efficient and specific transduction of heart tissue in mice model. CTP can be used to deliver therapeutic peptides, proteins and nucleic acid specifically to the heart[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
