Pep19-2.5 [CAS 1322711-38-5]
Partner: MedChemexpress LLC
| CAS No: | 1322711-38-5 |
| Applications: | COVID-19-immunoregulation |
| MW: | 2712.23 |
| Formula: | C135H187N37O22S |
| SMILES: | OC(CNC([C@H](CC1=CNC2=CC=CC=C12)NC([C@H](CC3=CC=CC=C3)NC([C@@H](NC([C@@H](NC([C@H](CCCCN)NC(CNC([C@H](CCCCN)NC([C@@H](NC([C@H](CCCCN)NC([C@@H](NC([C@H](CCCNC(N)=N)NC([C@@H](NC([C@H](CCCNC(N)=N)NC([C@H](CCCNC(N)=N)NC([C@@H](NC([C@H](CCCCN)NC([C@H](CCCCN)NC([C@H](CS)NC(CN)=O)=O)=O)=O)CC4=CC=C(C=C4)O)=O)=O)=O)CC5=CC=CC=C5)=O)=O)CC6=CNC7=CC=CC=C67)=O)=O)CC8=CC=CC=C8)=O)=O)=O)=O)CC9=CC=CC=C9)=O)CC%10=CNC%11=CC=CC=C%10%11)=O)=O)=O)=O |
| Purity: | 98.51 |
| Description: | Pep19-2.5 is an synthetic and antitoxin peptide, blocks the intracellular endotoxin signaling cascade. Pep19-2.5 inhibits signaling of lipopeptides (LP) and lipopolysaccharides (LPS) mediated by transmembrane and cytosolic pattern recognition receptors (PRRs). The signaling cascades lead to inflammation and cell pyroptosis[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
