P-113 [CAS 190673-58-6]
Partner: MedChemexpress LLC
| CAS No: | 190673-58-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 1563.81 |
| Formula: | C71H110N28O13 |
| SMILES: | OC(C=C1)=CC=C1C[C@@H](C(N[C@@H](CCCCN)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCCN)C(N[C@H](C(N[C@H](C(N)=O)CC2=CN=CN2)=O)CC3=CC=CC=C3)=O)=O)=O)=O)NC(CNC([C@H](CC4=CN=CN4)NC([C@@H](NC([C@H](CCCNC(N)=N)NC([C@@H](NC([C@@H](N)C)=O)CCCCN)=O)=O)CC5=CN=CN5)=O)=O)=O |
| Purity: | 98.26 |
| Description: | P-113 is an antimicrobial peptide (AMP) derived from the human salivary protein histatin 5. P-113 is active against clinically important microorganisms such as Pseudomonas spp., Staphylococcus spp., and C. albicans[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
