TNF-Alpha (31-45), human (TFA)
Partner: MedChemexpress LLC
| Applications: | COVID-19-immunoregulation |
| MW: | 1781.89 |
| Formula: | C71H123F3N26O24 |
| SMILES: | OC(C[C@@H](C(O)=O)NC([C@H](CCCNC(N)=N)NC([C@H](CC(C)C)NC([C@H](CCC(O)=O)NC([C@H](C(C)C)NC(CNC([C@H](CC(N)=O)NC([C@H](C)NC([C@H](CC(C)C)NC([C@H](CC(C)C)NC([C@H](C)NC([C@H](CC(N)=O)NC([C@H](C)NC([C@H](CCCNC(N)=N)NC([C@@H](N)CCCNC(N)=N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O.OC(C(F)(F)F)=O |
| Description: | TNF-? (31-45), human (TFA) is a peptide of tumor necrosis factor-?. Tumour necrosis factor alpha (TNF alpha) is an inflammatory cytokine that induces necrosis or apoptosis[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
