Abz-FR-K(Dnp)-P-OH [CAS 500799-61-1]
Partner: MedChemexpress LLC
| CAS No: | 500799-61-1 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 831.87 |
| Formula: | C39H49N11O10 |
| SMILES: | O=C(O)[C@H]1N(C([C@H](CCCCNC2=CC=C([N+]([O-])=O)C=C2[N+]([O-])=O)NC([C@H](CCCNC(N)=N)NC([C@H](CC3=CC=CC=C3)NC(C4=CC=CC=C4N)=O)=O)=O)=O)CCC1 |
| Purity: | 99.46 |
| Description: | Abz-FR-K(Dnp)-P-OH is an angiotensin I-converting enzyme (ACE) substrate and an internally quenched fluorogenic substrate for real time fluorescent assay[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
