Autocamtide 2, amide
Partner: MedChemexpress LLC
| Applications: | Neuroscience-Neuromodulation |
| MW: | 1526.78 |
| Formula: | C65H119N23O19 |
| SMILES: | O=C([C@@H](N)CCCCN)N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N)=O)CC(C)C)=O)C)=O)CC(O)=O)=O)C(C)C)=O)[C@@H](C)O)=O)CCC(O)=O)=O)CCC(N)=O)=O)CCCNC(N)=N)=O)CCCNC(N)=N)=O)CC(C)C)=O)C)=O)CCCCN |
| Purity: | 99.50 |
| Description: | Autocamtide 2, amide is a substrate (100 ?M final concentration) for CaMK family assays. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
