Substance P (1-9) [CAS 57468-17-4]
Partner: MedChemexpress LLC
| CAS No: | 57468-17-4 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 1104.26 |
| Formula: | C52H77N15O12 |
| SMILES: | O=C(N1[C@@H](CCC1)C(N[C@@H](CCCCN)C(N2[C@@H](CCC2)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCC(N)=O)C(N[C@@H](CC3=CC=CC=C3)C(N[C@@H](CC4=CC=CC=C4)C(NCC(O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CCCNC(N)=N)N |
| Purity: | 99.75 |
| Description: | Substance P (1-9) is nonapeptide, which decreases the inactivation of substance P by the guinea-pig ileum and urinary bladder. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
