Boc-Gly-Gly-Phe-Gly-OH (TFA) [CAS 2450273-39-7]
Partner: MedChemexpress LLC
| CAS No: | 2450273-39-7 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 550.48 |
| Formula: | C22H29F3N4O9 |
| SMILES: | CC(C)(C)OC(NCC(NCC(N[C@H](C(NCC(O)=O)=O)CC1=CC=CC=C1)=O)=O)=O.OC(C(F)(F)F)=O |
| Purity: | 98.27 |
| Description: | Boc-Gly-Gly-Phe-Gly-OH TFA, a self-assembly of N- and C-protected tetrapeptide, is a protease cleavable linker used for the antibody-drug conjugate (ADC). |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
