Compstatin control peptide [CAS 301544-78-5]
Partner: MedChemexpress LLC
| CAS No: | 301544-78-5 |
| Applications: | COVID-19-immunoregulation |
| MW: | 1488.65 |
| Formula: | C66H101N23O17 |
| SMILES: | CC[C@H](C)[C@H](N)C(N[C@@H](C)C(N[C@@H](C(C)C)C(N[C@@H](C(C)C)C(N[C@@H](CCC(N)=O)C(N[C@@H](CC(O)=O)C(N[C@H](C(NCC(N[C@H](C(N[C@H](C(N[C@@H](CCCNC(N)=N)C(N[C@@H](C)C(N[C@H](C(N)=O)[C@H](O)C)=O)=O)=O)CC1=CN=CN1)=O)CC2=CN=CN2)=O)=O)CC3=CNC4=CC=CC=C34)=O)=O)=O)=O)=O)=O |
| Purity: | 99.97 |
| Description: | Compstatin control peptide is a negative control of Compstatin (HY-P1036). Compstatin is a potent complement system C3 inhibitor[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
