PAR-4 Agonist Peptide, amide (TFA) [CAS 1228078-65-6]
Partner: MedChemexpress LLC
| CAS No: | 1228078-65-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 794.82 |
| Formula: | C36H49F3N8O9 |
| SMILES: | OC(C=C1)=CC=C1C[C@H](NC([C@@H](N)C)=O)C(N2[C@@H](CCC2)C(NCC(N[C@@H](CCCCN)C(N[C@H](C(N)=O)CC3=CC=CC=C3)=O)=O)=O)=O.OC(C(F)(F)F)=O |
| Purity: | 99.93 |
| Description: | PAR-4 Agonist Peptide, amide TFA (PAR-4-AP TFA; AY-NH2 TFA) is a proteinase-activated receptor-4 (PAR-4) agonist, which has no effect on either PAR-1 or PAR-2 and whose effects are blocked by a PAR-4 antagonist[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
