PG-931 [CAS 667430-81-1]
Partner: MedChemexpress LLC
| CAS No: | 667430-81-1 |
| Applications: | COVID-19-immunoregulation |
| MW: | 1180.40 |
| Formula: | C59H85N15O11 |
| SMILES: | O=C(N[C@@H](CCCCNC(C[C@@H](C(N1[C@](CCC1)([H])C(N[C@@H](C(N[C@H](C(N2)=O)CCCNC(N)=N)=O)CC3=CC=CC=C3)=O)=O)NC([C@@H](NC(C)=O)CCCC)=O)=O)C(N4[C@@H](CCC4)C(N[C@H](C(N)=O)C(C)C)=O)=O)[C@@H]2CC5=CNC6=CC=CC=C56 |
| Purity: | 99.86 |
| Description: | PG-931, an analog of SHU 9119 (HY-P0227), is a potent melanocortin 4 (MC4) receptor (IC50=0.58 nM) agonist and is more selective than for the hMC3R (IC50=55 nM) or the hMC5R (IC50=2.4 nM). PG-931 can reverse haemorrhagic shock and prevent multiple organ damage in vivo[2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
