GP(33-41) (TFA)
Partner: MedChemexpress LLC
| Applications: | COVID-19-anti-virus |
| MW: | 1130.19 |
| Formula: | C48H70F3N11O15S |
| SMILES: | O=C(N[C@@H](CC(N)=O)C(N[C@H](C(N[C@@H](C)C(N[C@@H]([C@H](O)C)C(N[C@@H](CS)C(O)=O)=O)=O)=O)CC1=CC=CC=C1)=O)[C@@H](NC([C@H](C(C)C)NC([C@H](C)NC([C@@H](N)CCCCN)=O)=O)=O)CC(C=C2)=CC=C2O.OC(C(F)(F)F)=O |
| Purity: | 99.70 |
| Description: | GP(33-41) TFA, a 9-aa-long peptide, is the optimal sequence of the GP1 epitope of lymphocytic choriomeningitis virus. GP(33-41) TFA can upregulate H-2Db molecules at the RMA-S (Db Kb) cell surface with a SC50 of 344 nM[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
