Neurokinin B (TFA) [CAS 101536-55-4]
Partner: MedChemexpress LLC
| CAS No: | 101536-55-4 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 1438.47 |
| Formula: | C55H79N13O14S2.2C2HF3O2 |
| SMILES: | O=C(N[C@@H](CC(N)=O)C(N[C@@H](CC(C)C)C(N[C@@H](CC1=CNC2=CC=CC=C12)C(N[C@@H](C)C(N[C@@H]([C@H](O)C)C(NCC(N[C@@H](CC3=CNC=N3)C(N[C@@H](CC4=CC=CC=C4)C(N[C@@H](CCSC)C(N)=O)=O)=O)=O)=O)=O)=O)=O)=O)CN.OC(C(F)(F)F)=O |
| Purity: | 96.64 |
| Description: | Neurokinin B TFA belongs to the tachykinin family of peptides. Neurokinin B binds a family of GPCRs-including neurokinin receptor 1 (NK1R), NK2R, and NK3R-to mediate their biological effect[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
