Neuromedin B [CAS 87096-84-2]
Partner: MedChemexpress LLC
| CAS No: | 87096-84-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 1132.29 |
| Formula: | C52H73N15O12S |
| SMILES: | NCC(N[C@@H](CC(N)=O)C(N[C@@H](CC(C)C)C(N[C@H](C(N[C@@H](C)C(N[C@@H]([C@H](O)C)C(NCC(N[C@H](C(N[C@H](C(N[C@H](C(N)=O)CCSC)=O)CC1=CC=CC=C1)=O)CC2=CN=CN2)=O)=O)=O)=O)CC3=CNC4=CC=CC=C34)=O)=O)=O |
| Purity: | 98.68 |
| Description: | Neuromedin B (NMB) is a member of Bombesin (BN)-like peptide family in mammals. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
