Autocamtide-2-related inhibitory peptide (TFA)
Partner: MedChemexpress LLC
| Applications: | Neuroscience-Neuromodulation |
| MW: | 1611.76 |
| Formula: | C66H126N22O21F3 |
| SMILES: | O=C(N[C@@H](CCCCN)C(N[C@@H](C)C(N[C@@H](CC(C)C)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCC(O)=O)C(N[C@@H](C)C(N[C@@H](C(C)C)C(N[C@@H](CC(O)=O)C(N[C@@H](C)C(N[C@@H](CC(C)C)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CCCCN)N.OC(C(F)(F)F)=O |
| Purity: | 95.24 |
| Description: | Autocamtide-2-related inhibitory peptide (TFA) is a highly specific and potent inhibitor of CaMKII with an IC50 of 40 nM. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
