Motixafortide [CAS 664334-36-5]
Partner: MedChemexpress LLC
| CAS No: | 664334-36-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 2159.52 |
| Formula: | C97H144FN33O19S2 |
| SMILES: | O=C1[C@@]2([H])N(CCC2)C([C@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CSSC[C@H](NC([C@@H](NC([C@@H](NC([C@@H](N1)CC3=CC=C(C=C3)O)=O)CCCNC(N)=N)=O)CCCNC(N)=O)=O)C(N[C@H](C(N)=O)CCCNC(N)=N)=O)NC([C@@H](NC([C@H](CCCNC(N)=N)NC([C@H](CCCNC(N)=N)NC(C4=CC=C(C=C4)F)=O)=O)=O)CC5=CC6=C(C=CC=C6)C=C5)=O)=O)CC7=CC=C(C=C7)O)=O)CCCNC(N)=O)=O)CCCCN)=O)CCCCN)=O |
| Purity: | 99.86 |
| Description: | Motixafortide (BKT140 4-fluorobenzoyl) is a novel CXCR4 antagonist with an IC50 vakue of ?1 nM. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
