Randialic acid B [CAS 14021-14-8]
Partner: MedChemexpress LLC
| CAS No: | 14021-14-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 454.68 |
| Formula: | C30H46O3 |
| SMILES: | OC([C@](CC[C@]12C)(CC[C@H]3C)C(C1=CC[C@@]4([H])[C@]2(CC[C@](C(C)5C)([H])[C@@]4(CC[C@@H]5O)C)C)=C3C)=O |
| Purity: | 99.94 |
| Description: | Randialic acid B, a triterpenoid compound, is a formyl peptide receptor 1 (FPR1) antagonist. Randialic acid B blocks FPR1 in human neutrophils and attenuates psoriasis-like inflammation in vivo[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
