24-Methylenecycloartanyl ferulate [CAS 469-36-3]
Partner: MedChemexpress LLC
| CAS No: | 469-36-3 |
| Applications: | Cancer-Kinase/protease |
| MW: | 616.91 |
| Formula: | C41H60O4 |
| SMILES: | CC1(C)[C@@H](OC(/C=C/C2=CC=C(O)C(OC)=C2)=O)CC[C@]3(C4)C54CC[C@]6(C)[C@@H]([C@H](C)CCC(C(C)C)=C)CC[C@](C)6[C@]5([H])CC[C@@]13[H] |
| Purity: | 98.05 |
| Description: | 24-Methylenecycloartanyl ferulate is a ?-oryzanol compound. 24-Methylenecycloartanyl ferulate promotes parvin-beta expression in human breast cancer cells. 24-Methylenecycloartanyl ferulate is a potential ATP-competitive Akt1 inhibitor (EC50= 33.3?M)[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
