Angoline [CAS 21080-31-9]
Partner: MedChemexpress LLC
| CAS No: | 21080-31-9 |
| Applications: | Cancer-Kinase/protease |
| MW: | 379.41 |
| Formula: | C22H21NO5 |
| SMILES: | CN1C2=C3C(C=C4OCOC4=C3)=CC=C2C5=C(C(OC)=C(OC)C=C5)C1OC |
| Purity: | 99.67 |
| Description: | Angoline is a potent and selective IL6/STAT3 signaling pathway inhibitor with an IC50 of 11.56 ?M. Angoline inhibits STAT3 phosphorylation and its target gene expression, and inhibits cancer cell proliferation[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
