(�)?-?Vasicine [CAS 6159-56-4]
Partner: MedChemexpress LLC
| CAS No: | 6159-56-4 |
| Applications: | COVID-19-immunoregulation |
| MW: | 188.23 |
| Formula: | C11H12N2O |
| SMILES: | OC1CCN2C1=NC3=C(C=CC=C3)C2 |
| Purity: | 99.0 |
| Description: | (�)-Vasicine is the racemate of Vasicine. Vasicine (Peganine) significantly inhibits H+-K+-ATPase activity�in vitro�with an IC50 of 73.47�?g/mL. Anti-ulcer activity. Vasicine shows significant anti-secretory, antioxidant and�cytoprotective�effect[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
