Mogroside IV-A [CAS 88901-41-1]
Partner: MedChemexpress LLC
| CAS No: | 88901-41-1 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 1125.29 |
| Formula: | C54H92O24 |
| SMILES: | C[C@]12[C@](CC=C3[C@@]2([H])CC[C@H](O[C@]4([H])O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)CO[C@@H]5O[C@@H]([C@@H](O)[C@H](O)[C@H]5O)CO)C3(C)C)([H])[C@]6([C@@](C)([C@]([C@H](C)CC[C@H](C(C)(O)C)O[C@@H]7O[C@@H]([C@@H](O)[C@H](O)[C@H]7O)CO[C@@H]8O[C@@H]([C@@H](O)[C@H](O)[C@H]8O)CO)([H])CC6)C[C@H]1O)C |
| Purity: | 99.56 |
| Description: | Mogroside IV-A, a triterpenoid glycoside isolated from the extracts of Luo Han Guo, is a nonsugar sweetener. Mogrosides are sweeter than sucrose. Mogrosides exhibit antioxidant, antidiabetic and anticancer activities[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
