ArnicolideC [CAS 34532-67-7]
Partner: MedChemexpress LLC
| CAS No: | 34532-67-7 |
| Applications: | COVID-19-immunoregulation |
| MW: | 334.41 |
| Formula: | C19H26O5 |
| SMILES: | CC(C)C(O[C@H]1[C@@]([C@@H]2C)([H])[C@@](OC2=O)([H])C[C@@H](C)[C@@]3([H])[C@]1(C(C=C3)=O)C)=O |
| Purity: | 99.77 |
| Description: | ArnicolideC is a sesquiterpene lactone isolated Centipeda minima[1]. ArnicolideC exertes a cytotoxic effect on the panel of Nasopharyngeal carcinoma (NPC) cells, significantly inhibiting cell growth in a dose- and time- dependent manner. ArnicolideC also exhibits inhibitory effects on NPC proliferation[2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
