Bafilomycin B1 [CAS 88899-56-3]
Partner: MedChemexpress LLC
| CAS No: | 88899-56-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 815.99 |
| Formula: | C44H65NO13 |
| SMILES: | O=C(O[C@@H]1C[C@@]([C@@H](C)[C@H](O)[C@@H]([C@H]([C@@H](OC)/C=C/C=C(C)/C[C@H](C)[C@H](O)[C@H](C)/C=C(C)/C=C2\OC)OC2=O)C)(O)O[C@H](C(C)C)[C@H]1C)/C=C/C(NC3=C(O)CCC3=O)=O |
| Purity: | 98.22 |
| Description: | Bafilomycin B1 is a macrolide antibiotic isolated from Streptomyces sp, inhibits Gram-positive bacteria and fungi, and acts as an inhibitor of K+-dependent ATPase of E. coli[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
