Mu lberrofuran Q [CAS 101383-35-1]
Partner: MedChemexpress LLC
| CAS No: | 101383-35-1 |
| Applications: | COVID-19-immunoregulation |
| MW: | 592.55 |
| Formula: | C34H24O10 |
| SMILES: | O=C1C2C3=C(C=C(C4=CC5=C(C=C(C=C5)O)O4)C=C3OC6(C7=CC=C(C=C7O)O)OC26C8C9=CC=C(C=C9OC1(C8)C)O)O |
| Description: | Mulberrofuran Q inhibits the formation of 12-hydroxy-5,8,10-heptadecatrienoic acid (HHT) and thromboxane B2 (cyclooxygenase products)[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
