Rosmanol [CAS 80225-53-2]
Partner: MedChemexpress LLC
| CAS No: | 80225-53-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 346.42 |
| Formula: | C20H26O5 |
| SMILES: | O=C1O[C@]2([H])[C@@H](O)C3=C(C(O)=C(O)C(C(C)C)=C3)[C@@]41CCCC(C)(C)[C@]24[H] |
| Purity: | 98.39 |
| Description: | Rosmanol could inhibit the oxidation of low density lipoprotein (LPL) and significantly inhibit lipopolysaccharide induced iNOS and COX-2 expression, with anti-inflammatory effect. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
