Taxifolin 7-O-rhamnoside [CAS 137592-12-2]
Partner: MedChemexpress LLC
| CAS No: | 137592-12-2 |
| Applications: | COVID-19-immunoregulation |
| MW: | 450.39 |
| Formula: | C21H22O11 |
| SMILES: | O=C1C2=C(O)C=C(O[C@H]3[C@@H]([C@@H]([C@@H](O)[C@H](C)O3)O)O)C=C2O[C@H](C4=CC(O)=C(O)C=C4)[C@H]1O |
| Purity: | 99.61 |
| Description: | Taxifolin 7-O-rhamnoside (Taxifolin 7-O-?-L-rhamnoside) is a flavonoid isolated from Hypericum japonicum. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
