Iriflophenone 3-C-glucoside [CAS 104669-02-5]
Partner: MedChemexpress LLC
| CAS No: | 104669-02-5 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 408.36 |
| Formula: | C19H20O10 |
| SMILES: | O=C(C1=C(O)C=C(O)C([C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)=C1O)C3=CC=C(O)C=C3 |
| Purity: | 99.48 |
| Description: | Iriflophenone 3-C-?-D-glucopyranoside, isolated from Cyclopia genistoides, has antioxidant activity[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
