Pachypodol [CAS 33708-72-4]
Partner: MedChemexpress LLC
| CAS No: | 33708-72-4 |
| Applications: | Cancer-programmed cell death |
| MW: | 344.32 |
| Formula: | C18H16O7 |
| SMILES: | O=C1C(OC)=C(C2=CC(OC)=C(O)C=C2)OC3=CC(OC)=CC(O)=C13 |
| Purity: | 99.82 |
| Description: | Pachypodol exerts antioxidant and cytoprotective effects in HepG2 cells[1].Pachypodol inhibits the growth of CaCo 2 colon cancer cell line in vitro(IC50 = 185.6 mM)[2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
