Mu rrayone [CAS 19668-69-0]
Partner: MedChemexpress LLC
| CAS No: | 19668-69-0 |
| Applications: | Cancer-programmed cell death |
| MW: | 258.27 |
| Formula: | C15H14O4 |
| SMILES: | O=C1C=CC2=CC=C(OC)C(CC(C(C)=C)=O)=C2O1 |
| Purity: | 99.44 |
| Description: | Murrayone, a coumarin-containing compound extracted from�M. paniculata,�is the most bioactive substance in this species and is a cancer metastasis chemopreventive agent based on its unique pharmacological properties[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
